C24H31ClN2O2S — CID 143087464
N-[5-[(E)-but-2-enyl]-1,3-thiazol-2-yl]-1-(4-methoxyphenyl)cyclopentane-1-carboxamide;(E)-2-chlorobut-2-ene (PubChem CID 143087464) has the molecular formula C24H31ClN2O2S and a molecular weight of 447.04 g/mol. Its IUPAC name is N-[5-[(E)-but-2-enyl]-1,3-thiazol-2-yl]-1-(4-methoxyphenyl)cyclopentane-1-carboxamide;(E)-2-chlorobut-2-ene.
| Compound Name | N-[5-[(E)-but-2-enyl]-1,3-thiazol-2-yl]-1-(4-methoxyphenyl)cyclopentane-1-carboxamide;(E)-2-chlorobut-2-ene |
|---|---|
| PubChem CID | 143087464 |
| Molecular Formula | C24H31ClN2O2S |
| Molecular Weight | 447.04 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | N-[5-[(E)-but-2-enyl]-1,3-thiazol-2-yl]-1-(4-methoxyphenyl)cyclopentane-1-carboxamide;(E)-2-chlorobut-2-ene |
| SMILES | C/C=C(\C)Cl.C/C=C/Cc1cnc(NC(=O)C2(c3ccc(OC)cc3)CCCC2)s1 |
| InChI | InChI=1S/C20H24N2O2S.C4H7Cl/c1-3-4-7-17-14-21-19(25-17)22-18(23)20(12-5-6-13-20)15-8-10-16(24-2)11-9-15;1-3-4(2)5/h3-4,8-11,14H,5-7,12-13H2,1-2H3,(H,21,22,23);3H,1-2H3/b2*4-3+ |
| InChIKey | ZKTSXXZWCBHBPX-XOMXBQTJSA-N |
| XLogP | 6.87 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.04 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|