C16H21F14NO2S — CID 143087531
N-butyl-6,7,7,7-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)heptane-1-sulfonamide (PubChem CID 143087531) has the molecular formula C16H21F14NO2S and a molecular weight of 557.39 g/mol. Its IUPAC name is N-butyl-6,7,7,7-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)heptane-1-sulfonamide.
| Compound Name | N-butyl-6,7,7,7-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)heptane-1-sulfonamide |
|---|---|
| PubChem CID | 143087531 |
| Molecular Formula | C16H21F14NO2S |
| Molecular Weight | 557.39 g/mol |
| Exact Mass | 557.11 |
| IUPAC Name | N-butyl-6,7,7,7-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)heptane-1-sulfonamide |
| SMILES | CCCCNS(=O)(=O)CCCC(CC(F)(C(F)(F)F)C(F)(F)F)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H21F14NO2S/c1-2-3-6-31-34(32,33)7-4-5-10(8-11(17,13(19,20)21)14(22,23)24)9-12(18,15(25,26)27)16(28,29)30/h10,31H,2-9H2,1H3 |
| InChIKey | XCIHXFJFEZQAMK-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.39 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|