About 6-iodo-4,6-bis(trifluoromethyl)oct-1-ene
6-iodo-4,6-bis(trifluoromethyl)oct-1-ene (PubChem CID 143087548) has the molecular formula C10H13F6I
and a molecular weight of 374.11 g/mol. Its IUPAC name is 6-iodo-4,6-bis(trifluoromethyl)oct-1-ene.
Molecular Properties
| Compound Name | 6-iodo-4,6-bis(trifluoromethyl)oct-1-ene |
| PubChem CID | 143087548 |
| Molecular Formula | C10H13F6I |
| Molecular Weight | 374.11 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | 6-iodo-4,6-bis(trifluoromethyl)oct-1-ene |
| SMILES | C=CCC(CC(I)(CC)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H13F6I/c1-3-5-7(9(11,12)13)6-8(17,4-2)10(14,15)16/h3,7H,1,4-6H2,2H3 |
| InChIKey | JDUVDVKGVRRAMR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.11 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-4,6-bis(trifluoromethyl)oct-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-4,6-bis(trifluoromethyl)oct-1-ene?
The IUPAC name of 6-iodo-4,6-bis(trifluoromethyl)oct-1-ene (CID 143087548) is 6-iodo-4,6-bis(trifluoromethyl)oct-1-ene.
What is the SMILES notation for 6-iodo-4,6-bis(trifluoromethyl)oct-1-ene?
The canonical SMILES for 6-iodo-4,6-bis(trifluoromethyl)oct-1-ene is C=CCC(CC(I)(CC)C(F)(F)F)C(F)(F)F.
What is the InChIKey of 6-iodo-4,6-bis(trifluoromethyl)oct-1-ene?
The InChIKey is JDUVDVKGVRRAMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F6I/c1-3-5-7(9(11,12)13)6-8(17,4-2)10(14,15)16/h3,7H,1,4-6H2,2H3.
What are the key properties of 6-iodo-4,6-bis(trifluoromethyl)oct-1-ene?
6-iodo-4,6-bis(trifluoromethyl)oct-1-ene has a molecular weight of 374.11 g/mol, XLogP of 5.28, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-4,6-bis(trifluoromethyl)oct-1-ene is sourced from PubChem (CID 143087548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).