C11H23F3N2O2S — CID 143087573
N-[3-(dimethylamino)propyl]-4,4,4-trifluoro-3,3-dimethylbutane-1-sulfonamide (PubChem CID 143087573) has the molecular formula C11H23F3N2O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-4,4,4-trifluoro-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | N-[3-(dimethylamino)propyl]-4,4,4-trifluoro-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 143087573 |
| Molecular Formula | C11H23F3N2O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-4,4,4-trifluoro-3,3-dimethylbutane-1-sulfonamide |
| SMILES | CN(C)CCCNS(=O)(=O)CCC(C)(C)C(F)(F)F |
| InChI | InChI=1S/C11H23F3N2O2S/c1-10(2,11(12,13)14)6-9-19(17,18)15-7-5-8-16(3)4/h15H,5-9H2,1-4H3 |
| InChIKey | XVMIEQFZAWXSHE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|