C10H6F10O — CID 143087866
5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene (PubChem CID 143087866) has the molecular formula C10H6F10O and a molecular weight of 332.14 g/mol. Its IUPAC name is 5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 143087866 |
| Molecular Formula | C10H6F10O |
| Molecular Weight | 332.14 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene |
| SMILES | FC(F)(F)C1C2C=CC(O2)C1C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H6F10O/c11-7(9(15,16)17,10(18,19)20)5-3-1-2-4(21-3)6(5)8(12,13)14/h1-6H |
| InChIKey | BQKYAZIBMLEPIB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.14 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|