C10H20F4N2O2S — CID 143087874
N-[3-(dimethylamino)propyl]-3,4,4,4-tetrafluoro-3-methylbutane-1-sulfonamide (PubChem CID 143087874) has the molecular formula C10H20F4N2O2S and a molecular weight of 308.34 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-3,4,4,4-tetrafluoro-3-methylbutane-1-sulfonamide.
| Compound Name | N-[3-(dimethylamino)propyl]-3,4,4,4-tetrafluoro-3-methylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 143087874 |
| Molecular Formula | C10H20F4N2O2S |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-3,4,4,4-tetrafluoro-3-methylbutane-1-sulfonamide |
| SMILES | CN(C)CCCNS(=O)(=O)CCC(C)(F)C(F)(F)F |
| InChI | InChI=1S/C10H20F4N2O2S/c1-9(11,10(12,13)14)5-8-19(17,18)15-6-4-7-16(2)3/h15H,4-8H2,1-3H3 |
| InChIKey | GVYYCDKIBXMGGF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|