C24H42N2O6 — CID 143088130
cis-(1R,3S)-3-(pent-4-enoylamino)cyclopentane-1-carboxylic acid;ethane;6-(pent-4-enoylamino)hexanoic acid (PubChem CID 143088130) has the molecular formula C24H42N2O6 and a molecular weight of 454.61 g/mol. Its IUPAC name is cis-(1R,3S)-3-(pent-4-enoylamino)cyclopentane-1-carboxylic acid;ethane;6-(pent-4-enoylamino)hexanoic acid.
| Compound Name | cis-(1R,3S)-3-(pent-4-enoylamino)cyclopentane-1-carboxylic acid;ethane;6-(pent-4-enoylamino)hexanoic acid |
|---|---|
| PubChem CID | 143088130 |
| Molecular Formula | C24H42N2O6 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.30 |
| IUPAC Name | cis-(1R,3S)-3-(pent-4-enoylamino)cyclopentane-1-carboxylic acid;ethane;6-(pent-4-enoylamino)hexanoic acid |
| SMILES | C=CCCC(=O)NCCCCCC(=O)O.C=CCCC(=O)N[C@H]1CC[C@@H](C(=O)O)C1.CC |
| InChI | InChI=1S/C11H17NO3.C11H19NO3.C2H6/c1-2-3-4-10(13)12-9-6-5-8(7-9)11(14)15;1-2-3-7-10(13)12-9-6-4-5-8-11(14)15;1-2/h2,8-9H,1,3-7H2,(H,12,13)(H,14,15);2H,1,3-9H2,(H,12,13)(H,14,15);1-2H3/t8-,9+;;/m1../s1 |
| InChIKey | GHQUEFJOUYQWAQ-BPRGXCPLSA-N |
| XLogP | 4.06 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|