C15H21F2NO — CID 143088568
(3R,5S)-4-[4-(1,1-difluoroethyl)phenyl]-3,5-dimethylpiperidin-4-ol (PubChem CID 143088568) has the molecular formula C15H21F2NO and a molecular weight of 269.33 g/mol. Its IUPAC name is (3R,5S)-4-[4-(1,1-difluoroethyl)phenyl]-3,5-dimethylpiperidin-4-ol.
| Compound Name | (3R,5S)-4-[4-(1,1-difluoroethyl)phenyl]-3,5-dimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 143088568 |
| Molecular Formula | C15H21F2NO |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | (3R,5S)-4-[4-(1,1-difluoroethyl)phenyl]-3,5-dimethylpiperidin-4-ol |
| SMILES | C[C@@H]1CNC[C@H](C)C1(O)c1ccc(C(C)(F)F)cc1 |
| InChI | InChI=1S/C15H21F2NO/c1-10-8-18-9-11(2)15(10,19)13-6-4-12(5-7-13)14(3,16)17/h4-7,10-11,18-19H,8-9H2,1-3H3/t10-,11+,15? |
| InChIKey | IICCTHFRBKVHPI-YWXMQNBFSA-N |
| XLogP | 2.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |