C21H35FN4O2 — CID 143088832
N-butan-2-yl-1-[3-[[2-(2-cyano-4-fluoropyrrolidin-1-yl)-2-oxoethyl]amino]propyl]cyclohexane-1-carboxamide (PubChem CID 143088832) has the molecular formula C21H35FN4O2 and a molecular weight of 394.54 g/mol. Its IUPAC name is N-butan-2-yl-1-[3-[[2-(2-cyano-4-fluoropyrrolidin-1-yl)-2-oxoethyl]amino]propyl]cyclohexane-1-carboxamide.
| Compound Name | N-butan-2-yl-1-[3-[[2-(2-cyano-4-fluoropyrrolidin-1-yl)-2-oxoethyl]amino]propyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 143088832 |
| Molecular Formula | C21H35FN4O2 |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | N-butan-2-yl-1-[3-[[2-(2-cyano-4-fluoropyrrolidin-1-yl)-2-oxoethyl]amino]propyl]cyclohexane-1-carboxamide |
| SMILES | CCC(C)NC(=O)C1(CCCNCC(=O)N2CC(F)CC2C#N)CCCCC1 |
| InChI | InChI=1S/C21H35FN4O2/c1-3-16(2)25-20(28)21(8-5-4-6-9-21)10-7-11-24-14-19(27)26-15-17(22)12-18(26)13-23/h16-18,24H,3-12,14-15H2,1-2H3,(H,25,28) |
| InChIKey | PZKRULRGRILHJG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|