C32H48BrN5O3S — CID 143089896
N-[3-[[3-bromo-5-[(2Z,6Z)-8-hydroxynona-2,6,8-trienyl]-4,5-dihydropyrazolo[1,5-a]pyrimidin-7-yl]amino]propyl]-N,2,7-trimethylcyclohepta-1,3,6-triene-1-sulfonamide;butane (PubChem CID 143089896) has the molecular formula C32H48BrN5O3S and a molecular weight of 662.74 g/mol. Its IUPAC name is N-[3-[[3-bromo-5-[(2Z,6Z)-8-hydroxynona-2,6,8-trienyl]-4,5-dihydropyrazolo[1,5-a]pyrimidin-7-yl]amino]propyl]-N,2,7-trimethylcyclohepta-1,3,6-triene-1-sulfonamide;butane.
| Compound Name | N-[3-[[3-bromo-5-[(2Z,6Z)-8-hydroxynona-2,6,8-trienyl]-4,5-dihydropyrazolo[1,5-a]pyrimidin-7-yl]amino]propyl]-N,2,7-trimethylcyclohepta-1,3,6-triene-1-sulfonamide;butane |
|---|---|
| PubChem CID | 143089896 |
| Molecular Formula | C32H48BrN5O3S |
| Molecular Weight | 662.74 g/mol |
| Exact Mass | 661.27 |
| IUPAC Name | N-[3-[[3-bromo-5-[(2Z,6Z)-8-hydroxynona-2,6,8-trienyl]-4,5-dihydropyrazolo[1,5-a]pyrimidin-7-yl]amino]propyl]-N,2,7-trimethylcyclohepta-1,3,6-triene-1-sulfonamide;butane |
| SMILES | C=C(O)/C=C\CC/C=C\CC1C=C(NCCCN(C)S(=O)(=O)C2=C(C)C=CCC=C2C)n2ncc(Br)c2N1.CCCC |
| InChI | InChI=1S/C28H38BrN5O3S.C4H10/c1-21-13-10-11-14-22(2)27(21)38(36,37)33(4)18-12-17-30-26-19-24(32-28-25(29)20-31-34(26)28)16-9-7-5-6-8-15-23(3)35;1-3-4-2/h7-10,13-15,19-20,24,30,32,35H,3,5-6,11-12,16-18H2,1-2,4H3;3-4H2,1-2H3/b9-7-,15-8-; |
| InChIKey | OUUXUCLOUXLMFP-ZVAAPNIVSA-N |
| XLogP | 7.82 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.74 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|