C29H48O2 — CID 14308997
6-[(3S,5S,8R,9S,10S,13S,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,3,6-trimethylhept-2-en-4-one (PubChem CID 14308997) has the molecular formula C29H48O2 and a molecular weight of 428.70 g/mol. Its IUPAC name is 6-[(3S,5S,8R,9S,10S,13S,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,3,6-trimethylhept-2-en-4-one.
| Compound Name | 6-[(3S,5S,8R,9S,10S,13S,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,3,6-trimethylhept-2-en-4-one |
|---|---|
| PubChem CID | 14308997 |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | 6-[(3S,5S,8R,9S,10S,13S,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,3,6-trimethylhept-2-en-4-one |
| SMILES | CC(C)=C(C)C(=O)CC(C)(C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H48O2/c1-18(2)19(3)25(31)17-27(4,5)26-11-10-23-22-9-8-20-16-21(30)12-14-28(20,6)24(22)13-15-29(23,26)7/h20-24,26,30H,8-17H2,1-7H3/t20-,21-,22-,23-,24-,26+,28-,29-/m0/s1 |
| InChIKey | ZUVIBFBCGVWCGE-TZWKHMJRSA-N |
| XLogP | 7.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|