C20H13BrFN5O2S — CID 143090058
[4-[[[3-bromo-5-(2-fluorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]methyl]phenyl]sulfonylformonitrile (PubChem CID 143090058) has the molecular formula C20H13BrFN5O2S and a molecular weight of 486.33 g/mol. Its IUPAC name is [4-[[[3-bromo-5-(2-fluorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]methyl]phenyl]sulfonylformonitrile.
| Compound Name | [4-[[[3-bromo-5-(2-fluorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]methyl]phenyl]sulfonylformonitrile |
|---|---|
| PubChem CID | 143090058 |
| Molecular Formula | C20H13BrFN5O2S |
| Molecular Weight | 486.33 g/mol |
| Exact Mass | 485.00 |
| IUPAC Name | [4-[[[3-bromo-5-(2-fluorophenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]methyl]phenyl]sulfonylformonitrile |
| SMILES | N#CS(=O)(=O)c1ccc(CNc2cc(-c3ccccc3F)nc3c(Br)cnn23)cc1 |
| InChI | InChI=1S/C20H13BrFN5O2S/c21-16-11-25-27-19(9-18(26-20(16)27)15-3-1-2-4-17(15)22)24-10-13-5-7-14(8-6-13)30(28,29)12-23/h1-9,11,24H,10H2 |
| InChIKey | NXEWVEUOYMGQBC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'sulfonyl_cyanide', 'substructure': 'N/A'} |
|---|