C29H39N5 — CID 143090582
1-ethenyl-3-ethynylcyclohexa-1,3-diene;N'-[3-ethyl-5-[(1E,3Z,5Z)-2-methylhepta-1,3,5-trienyl]-6,7-dihydropyrazolo[1,5-a]pyrimidin-7-yl]-N-methylethane-1,2-diamine (PubChem CID 143090582) has the molecular formula C29H39N5 and a molecular weight of 457.67 g/mol. Its IUPAC name is 1-ethenyl-3-ethynylcyclohexa-1,3-diene;N'-[3-ethyl-5-[(1E,3Z,5Z)-2-methylhepta-1,3,5-trienyl]-6,7-dihydropyrazolo[1,5-a]pyrimidin-7-yl]-N-methylethane-1,2-diamine.
| Compound Name | 1-ethenyl-3-ethynylcyclohexa-1,3-diene;N'-[3-ethyl-5-[(1E,3Z,5Z)-2-methylhepta-1,3,5-trienyl]-6,7-dihydropyrazolo[1,5-a]pyrimidin-7-yl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 143090582 |
| Molecular Formula | C29H39N5 |
| Molecular Weight | 457.67 g/mol |
| Exact Mass | 457.32 |
| IUPAC Name | 1-ethenyl-3-ethynylcyclohexa-1,3-diene;N'-[3-ethyl-5-[(1E,3Z,5Z)-2-methylhepta-1,3,5-trienyl]-6,7-dihydropyrazolo[1,5-a]pyrimidin-7-yl]-N-methylethane-1,2-diamine |
| SMILES | C#CC1=CCCC(C=C)=C1.C/C=C\C=C/C(C)=C/C1=Nc2c(CC)cnn2C(NCCNC)C1 |
| InChI | InChI=1S/C19H29N5.C10H10/c1-5-7-8-9-15(3)12-17-13-18(21-11-10-20-4)24-19(23-17)16(6-2)14-22-24;1-3-9-6-5-7-10(4-2)8-9/h5,7-9,12,14,18,20-21H,6,10-11,13H2,1-4H3;1,4,6,8H,2,5,7H2/b7-5-,9-8-,15-12+; |
| InChIKey | VFACZPAXSKONLJ-CUPVBUIQSA-N |
| XLogP | 5.76 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.67 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|