About 3-bromo-5-(furan-3-yl)-7-methylpyrazolo[1,5-a]pyrimidine;ethane
3-bromo-5-(furan-3-yl)-7-methylpyrazolo[1,5-a]pyrimidine;ethane (PubChem CID 143090704) has the molecular formula C13H14BrN3O
and a molecular weight of 308.18 g/mol. Its IUPAC name is 3-bromo-5-(furan-3-yl)-7-methylpyrazolo[1,5-a]pyrimidine;ethane.
Molecular Properties
| Compound Name | 3-bromo-5-(furan-3-yl)-7-methylpyrazolo[1,5-a]pyrimidine;ethane |
| PubChem CID | 143090704 |
| Molecular Formula | C13H14BrN3O |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 3-bromo-5-(furan-3-yl)-7-methylpyrazolo[1,5-a]pyrimidine;ethane |
| SMILES | CC.Cc1cc(-c2ccoc2)nc2c(Br)cnn12 |
| InChI | InChI=1S/C11H8BrN3O.C2H6/c1-7-4-10(8-2-3-16-6-8)14-11-9(12)5-13-15(7)11;1-2/h2-6H,1H3;1-2H3 |
| InChIKey | PCRIVXJXUZKRSX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 43.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-5-(furan-3-yl)-7-methylpyrazolo[1,5-a]pyrimidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-(furan-3-yl)-7-methylpyrazolo[1,5-a]pyrimidine;ethane?
The IUPAC name of 3-bromo-5-(furan-3-yl)-7-methylpyrazolo[1,5-a]pyrimidine;ethane (CID 143090704) is 3-bromo-5-(furan-3-yl)-7-methylpyrazolo[1,5-a]pyrimidine;ethane.
What is the SMILES notation for 3-bromo-5-(furan-3-yl)-7-methylpyrazolo[1,5-a]pyrimidine;ethane?
The canonical SMILES for 3-bromo-5-(furan-3-yl)-7-methylpyrazolo[1,5-a]pyrimidine;ethane is CC.Cc1cc(-c2ccoc2)nc2c(Br)cnn12.
What is the InChIKey of 3-bromo-5-(furan-3-yl)-7-methylpyrazolo[1,5-a]pyrimidine;ethane?
The InChIKey is PCRIVXJXUZKRSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrN3O.C2H6/c1-7-4-10(8-2-3-16-6-8)14-11-9(12)5-13-15(7)11;1-2/h2-6H,1H3;1-2H3.
What are the key properties of 3-bromo-5-(furan-3-yl)-7-methylpyrazolo[1,5-a]pyrimidine;ethane?
3-bromo-5-(furan-3-yl)-7-methylpyrazolo[1,5-a]pyrimidine;ethane has a molecular weight of 308.18 g/mol, XLogP of 4.09, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-(furan-3-yl)-7-methylpyrazolo[1,5-a]pyrimidine;ethane is sourced from PubChem (CID 143090704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).