About (4Z)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1-[(2E)-penta-2,4-dienyl]azepane
(4Z)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1-[(2E)-penta-2,4-dienyl]azepane (PubChem CID 143090879) has the molecular formula C18H27NO2
and a molecular weight of 289.42 g/mol. Its IUPAC name is (4Z)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1-[(2E)-penta-2,4-dienyl]azepane.
Molecular Properties
| Compound Name | (4Z)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1-[(2E)-penta-2,4-dienyl]azepane |
| PubChem CID | 143090879 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (4Z)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1-[(2E)-penta-2,4-dienyl]azepane |
| SMILES | C=C/C=C/CN1CCC(=C)/C(=C\C(OC)=C(/C)OC)CC1 |
| InChI | InChI=1S/C18H27NO2/c1-6-7-8-11-19-12-9-15(2)17(10-13-19)14-18(21-5)16(3)20-4/h6-8,14H,1-2,9-13H2,3-5H3/b8-7+,17-14-,18-16- |
| InChIKey | PLXDMOMUDJYCIM-ONHCOHSSSA-N |
| XLogP | 3.83 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1-[(2E)-penta-2,4-dienyl]azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1-[(2E)-penta-2,4-dienyl]azepane?
The IUPAC name of (4Z)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1-[(2E)-penta-2,4-dienyl]azepane (CID 143090879) is (4Z)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1-[(2E)-penta-2,4-dienyl]azepane.
What is the SMILES notation for (4Z)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1-[(2E)-penta-2,4-dienyl]azepane?
The canonical SMILES for (4Z)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1-[(2E)-penta-2,4-dienyl]azepane is C=C/C=C/CN1CCC(=C)/C(=C\C(OC)=C(/C)OC)CC1.
What is the InChIKey of (4Z)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1-[(2E)-penta-2,4-dienyl]azepane?
The InChIKey is PLXDMOMUDJYCIM-ONHCOHSSSA-N. The full InChI is InChI=1S/C18H27NO2/c1-6-7-8-11-19-12-9-15(2)17(10-13-19)14-18(21-5)16(3)20-4/h6-8,14H,1-2,9-13H2,3-5H3/b8-7+,17-14-,18-16-.
What are the key properties of (4Z)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1-[(2E)-penta-2,4-dienyl]azepane?
(4Z)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1-[(2E)-penta-2,4-dienyl]azepane has a molecular weight of 289.42 g/mol, XLogP of 3.83, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-5-methylidene-1-[(2E)-penta-2,4-dienyl]azepane is sourced from PubChem (CID 143090879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).