C12H16ClN — CID 143091843
(1R,5S)-1-[(3E,5E)-6-chlorohepta-1,3,5-trien-3-yl]-3-azabicyclo[3.1.0]hexane (PubChem CID 143091843) has the molecular formula C12H16ClN and a molecular weight of 209.72 g/mol. Its IUPAC name is (1R,5S)-1-[(3E,5E)-6-chlorohepta-1,3,5-trien-3-yl]-3-azabicyclo[3.1.0]hexane.
| Compound Name | (1R,5S)-1-[(3E,5E)-6-chlorohepta-1,3,5-trien-3-yl]-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 143091843 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | (1R,5S)-1-[(3E,5E)-6-chlorohepta-1,3,5-trien-3-yl]-3-azabicyclo[3.1.0]hexane |
| SMILES | C=C/C(=C\C=C(/C)Cl)[C@]12CNC[C@H]1C2 |
| InChI | InChI=1S/C12H16ClN/c1-3-10(5-4-9(2)13)12-6-11(12)7-14-8-12/h3-5,11,14H,1,6-8H2,2H3/b9-4+,10-5+/t11-,12+/m1/s1 |
| InChIKey | FIEGYCXCEUUTDR-GCKRLQMPSA-N |
| XLogP | 2.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|