C20H27NO5S — CID 143091986
N-[2-(2,4-dimethoxyphenyl)-1-(4-methylphenyl)sulfonylethyl]formamide;ethane (PubChem CID 143091986) has the molecular formula C20H27NO5S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[2-(2,4-dimethoxyphenyl)-1-(4-methylphenyl)sulfonylethyl]formamide;ethane.
| Compound Name | N-[2-(2,4-dimethoxyphenyl)-1-(4-methylphenyl)sulfonylethyl]formamide;ethane |
|---|---|
| PubChem CID | 143091986 |
| Molecular Formula | C20H27NO5S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | N-[2-(2,4-dimethoxyphenyl)-1-(4-methylphenyl)sulfonylethyl]formamide;ethane |
| SMILES | CC.COc1ccc(CC(NC=O)S(=O)(=O)c2ccc(C)cc2)c(OC)c1 |
| InChI | InChI=1S/C18H21NO5S.C2H6/c1-13-4-8-16(9-5-13)25(21,22)18(19-12-20)10-14-6-7-15(23-2)11-17(14)24-3;1-2/h4-9,11-12,18H,10H2,1-3H3,(H,19,20);1-2H3 |
| InChIKey | KKNFCRCFZFIUGG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|