C22H24ClN3O3S2 — CID 143092333
3-[2-chloro-4-(propan-2-ylamino)sulfanylphenoxy]-5-propan-2-yloxy-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 143092333) has the molecular formula C22H24ClN3O3S2 and a molecular weight of 478.04 g/mol. Its IUPAC name is 3-[2-chloro-4-(propan-2-ylamino)sulfanylphenoxy]-5-propan-2-yloxy-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-[2-chloro-4-(propan-2-ylamino)sulfanylphenoxy]-5-propan-2-yloxy-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 143092333 |
| Molecular Formula | C22H24ClN3O3S2 |
| Molecular Weight | 478.04 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 3-[2-chloro-4-(propan-2-ylamino)sulfanylphenoxy]-5-propan-2-yloxy-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | CC(C)NSc1ccc(Oc2cc(OC(C)C)cc(C(=O)Nc3nccs3)c2)c(Cl)c1 |
| InChI | InChI=1S/C22H24ClN3O3S2/c1-13(2)26-31-18-5-6-20(19(23)12-18)29-17-10-15(9-16(11-17)28-14(3)4)21(27)25-22-24-7-8-30-22/h5-14,26H,1-4H3,(H,24,25,27) |
| InChIKey | HKUNMVZPZXGVFR-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.04 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|