C22H33N3O — CID 143092704
(E)-N-[[4-(2-cyclohepta-1,3,5-trien-1-ylethylamino)cyclohexyl]methyl]-2-(methyliminomethyl)but-2-enamide (PubChem CID 143092704) has the molecular formula C22H33N3O and a molecular weight of 355.53 g/mol. Its IUPAC name is (E)-N-[[4-(2-cyclohepta-1,3,5-trien-1-ylethylamino)cyclohexyl]methyl]-2-(methyliminomethyl)but-2-enamide.
| Compound Name | (E)-N-[[4-(2-cyclohepta-1,3,5-trien-1-ylethylamino)cyclohexyl]methyl]-2-(methyliminomethyl)but-2-enamide |
|---|---|
| PubChem CID | 143092704 |
| Molecular Formula | C22H33N3O |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.26 |
| IUPAC Name | (E)-N-[[4-(2-cyclohepta-1,3,5-trien-1-ylethylamino)cyclohexyl]methyl]-2-(methyliminomethyl)but-2-enamide |
| SMILES | C/C=C(\C=N\C)C(=O)NCC1CCC(NCCC2=CC=CC=CC2)CC1 |
| InChI | InChI=1S/C22H33N3O/c1-3-20(17-23-2)22(26)25-16-19-10-12-21(13-11-19)24-15-14-18-8-6-4-5-7-9-18/h3-8,17,19,21,24H,9-16H2,1-2H3,(H,25,26)/b20-3+,23-17+ |
| InChIKey | USZQXRFIUOMLJQ-ZCSNTDHYSA-N |
| XLogP | 3.73 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|