C45H39N3 — CID 143092809
1-N-(3-amino-4-methylphenyl)-6-N-(3,4-dimethylphenyl)-1-N,6-N-bis(3-methylphenyl)pyrene-1,6-diamine (PubChem CID 143092809) has the molecular formula C45H39N3 and a molecular weight of 621.83 g/mol. Its IUPAC name is 1-N-(3-amino-4-methylphenyl)-6-N-(3,4-dimethylphenyl)-1-N,6-N-bis(3-methylphenyl)pyrene-1,6-diamine.
| Compound Name | 1-N-(3-amino-4-methylphenyl)-6-N-(3,4-dimethylphenyl)-1-N,6-N-bis(3-methylphenyl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 143092809 |
| Molecular Formula | C45H39N3 |
| Molecular Weight | 621.83 g/mol |
| Exact Mass | 621.31 |
| IUPAC Name | 1-N-(3-amino-4-methylphenyl)-6-N-(3,4-dimethylphenyl)-1-N,6-N-bis(3-methylphenyl)pyrene-1,6-diamine |
| SMILES | Cc1cccc(N(c2ccc(C)c(C)c2)c2ccc3ccc4c(N(c5cccc(C)c5)c5ccc(C)c(N)c5)ccc5ccc2c3c54)c1 |
| InChI | InChI=1S/C45H39N3/c1-28-8-6-10-35(24-28)47(37-18-12-30(3)32(5)26-37)42-22-16-33-15-21-40-43(23-17-34-14-20-39(42)44(33)45(34)40)48(36-11-7-9-29(2)25-36)38-19-13-31(4)41(46)27-38/h6-27H,46H2,1-5H3 |
| InChIKey | PNWVJBXFJXSZJO-UHFFFAOYSA-N |
| XLogP | 12.65 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.83 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|