C31H26N2OS — CID 143092820
6-(1-benzothiophen-3-yl)-4-[(3E)-5,6-dimethyl-2-pyridin-2-ylhepta-1,3,5-trien-3-yl]oxyquinoline (PubChem CID 143092820) has the molecular formula C31H26N2OS and a molecular weight of 474.63 g/mol. Its IUPAC name is 6-(1-benzothiophen-3-yl)-4-[(3E)-5,6-dimethyl-2-pyridin-2-ylhepta-1,3,5-trien-3-yl]oxyquinoline.
| Compound Name | 6-(1-benzothiophen-3-yl)-4-[(3E)-5,6-dimethyl-2-pyridin-2-ylhepta-1,3,5-trien-3-yl]oxyquinoline |
|---|---|
| PubChem CID | 143092820 |
| Molecular Formula | C31H26N2OS |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 6-(1-benzothiophen-3-yl)-4-[(3E)-5,6-dimethyl-2-pyridin-2-ylhepta-1,3,5-trien-3-yl]oxyquinoline |
| SMILES | C=C(/C(=C\C(C)=C(C)C)Oc1ccnc2ccc(-c3csc4ccccc34)cc12)c1ccccn1 |
| InChI | InChI=1S/C31H26N2OS/c1-20(2)21(3)17-30(22(4)27-10-7-8-15-32-27)34-29-14-16-33-28-13-12-23(18-25(28)29)26-19-35-31-11-6-5-9-24(26)31/h5-19H,4H2,1-3H3/b30-17+ |
| InChIKey | UIBPPXOGKQHLDT-OCSSWDANSA-N |
| XLogP | 8.84 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|