About (3S)-2'-methyl-3-propylspiro[cyclohexane-1,9'-fluorene]
(3S)-2'-methyl-3-propylspiro[cyclohexane-1,9'-fluorene] (PubChem CID 143093032) has the molecular formula C22H26
and a molecular weight of 290.45 g/mol. Its IUPAC name is (3S)-2'-methyl-3-propylspiro[cyclohexane-1,9'-fluorene].
Molecular Properties
| Compound Name | (3S)-2'-methyl-3-propylspiro[cyclohexane-1,9'-fluorene] |
| PubChem CID | 143093032 |
| Molecular Formula | C22H26 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (3S)-2'-methyl-3-propylspiro[cyclohexane-1,9'-fluorene] |
| SMILES | CCC[C@H]1CCCC2(C1)c1ccccc1-c1ccc(C)cc12 |
| InChI | InChI=1S/C22H26/c1-3-7-17-8-6-13-22(15-17)20-10-5-4-9-18(20)19-12-11-16(2)14-21(19)22/h4-5,9-12,14,17H,3,6-8,13,15H2,1-2H3/t17-,22?/m0/s1 |
| InChIKey | QEFUKWYZYSDAJZ-LBOXEOMUSA-N |
| XLogP | 6.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (3S)-2'-methyl-3-propylspiro[cyclohexane-1,9'-fluorene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-2'-methyl-3-propylspiro[cyclohexane-1,9'-fluorene]?
The IUPAC name of (3S)-2'-methyl-3-propylspiro[cyclohexane-1,9'-fluorene] (CID 143093032) is (3S)-2'-methyl-3-propylspiro[cyclohexane-1,9'-fluorene].
What is the SMILES notation for (3S)-2'-methyl-3-propylspiro[cyclohexane-1,9'-fluorene]?
The canonical SMILES for (3S)-2'-methyl-3-propylspiro[cyclohexane-1,9'-fluorene] is CCC[C@H]1CCCC2(C1)c1ccccc1-c1ccc(C)cc12.
What is the InChIKey of (3S)-2'-methyl-3-propylspiro[cyclohexane-1,9'-fluorene]?
The InChIKey is QEFUKWYZYSDAJZ-LBOXEOMUSA-N. The full InChI is InChI=1S/C22H26/c1-3-7-17-8-6-13-22(15-17)20-10-5-4-9-18(20)19-12-11-16(2)14-21(19)22/h4-5,9-12,14,17H,3,6-8,13,15H2,1-2H3/t17-,22?/m0/s1.
What are the key properties of (3S)-2'-methyl-3-propylspiro[cyclohexane-1,9'-fluorene]?
(3S)-2'-methyl-3-propylspiro[cyclohexane-1,9'-fluorene] has a molecular weight of 290.45 g/mol, XLogP of 6.25, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2'-methyl-3-propylspiro[cyclohexane-1,9'-fluorene] is sourced from PubChem (CID 143093032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).