About (2S)-3'-[(Z)-but-1-enyl]-2-ethyl-2'-methylspiro[cyclopentane-1,1'-indene]
(2S)-3'-[(Z)-but-1-enyl]-2-ethyl-2'-methylspiro[cyclopentane-1,1'-indene] (PubChem CID 143093039) has the molecular formula C20H26
and a molecular weight of 266.43 g/mol. Its IUPAC name is (2S)-3'-[(Z)-but-1-enyl]-2-ethyl-2'-methylspiro[cyclopentane-1,1'-indene].
Molecular Properties
| Compound Name | (2S)-3'-[(Z)-but-1-enyl]-2-ethyl-2'-methylspiro[cyclopentane-1,1'-indene] |
| PubChem CID | 143093039 |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | (2S)-3'-[(Z)-but-1-enyl]-2-ethyl-2'-methylspiro[cyclopentane-1,1'-indene] |
| SMILES | CC/C=C\C1=C(C)C2(CCC[C@@H]2CC)c2ccccc21 |
| InChI | InChI=1S/C20H26/c1-4-6-11-17-15(3)20(14-9-10-16(20)5-2)19-13-8-7-12-18(17)19/h6-8,11-13,16H,4-5,9-10,14H2,1-3H3/b11-6-/t16-,20?/m0/s1 |
| InChIKey | UAAUPKMGOANOAN-CXZLVDHESA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (2S)-3'-[(Z)-but-1-enyl]-2-ethyl-2'-methylspiro[cyclopentane-1,1'-indene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3'-[(Z)-but-1-enyl]-2-ethyl-2'-methylspiro[cyclopentane-1,1'-indene]?
The IUPAC name of (2S)-3'-[(Z)-but-1-enyl]-2-ethyl-2'-methylspiro[cyclopentane-1,1'-indene] (CID 143093039) is (2S)-3'-[(Z)-but-1-enyl]-2-ethyl-2'-methylspiro[cyclopentane-1,1'-indene].
What is the SMILES notation for (2S)-3'-[(Z)-but-1-enyl]-2-ethyl-2'-methylspiro[cyclopentane-1,1'-indene]?
The canonical SMILES for (2S)-3'-[(Z)-but-1-enyl]-2-ethyl-2'-methylspiro[cyclopentane-1,1'-indene] is CC/C=C\C1=C(C)C2(CCC[C@@H]2CC)c2ccccc21.
What is the InChIKey of (2S)-3'-[(Z)-but-1-enyl]-2-ethyl-2'-methylspiro[cyclopentane-1,1'-indene]?
The InChIKey is UAAUPKMGOANOAN-CXZLVDHESA-N. The full InChI is InChI=1S/C20H26/c1-4-6-11-17-15(3)20(14-9-10-16(20)5-2)19-13-8-7-12-18(17)19/h6-8,11-13,16H,4-5,9-10,14H2,1-3H3/b11-6-/t16-,20?/m0/s1.
What are the key properties of (2S)-3'-[(Z)-but-1-enyl]-2-ethyl-2'-methylspiro[cyclopentane-1,1'-indene]?
(2S)-3'-[(Z)-but-1-enyl]-2-ethyl-2'-methylspiro[cyclopentane-1,1'-indene] has a molecular weight of 266.43 g/mol, XLogP of 5.89, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3'-[(Z)-but-1-enyl]-2-ethyl-2'-methylspiro[cyclopentane-1,1'-indene] is sourced from PubChem (CID 143093039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).