About (Z)-but-2-ene;(E)-3-[4-(3-phenylprop-1-en-2-ylamino)phenyl]prop-2-enoic acid
(Z)-but-2-ene;(E)-3-[4-(3-phenylprop-1-en-2-ylamino)phenyl]prop-2-enoic acid (PubChem CID 143093733) has the molecular formula C22H25NO2
and a molecular weight of 335.45 g/mol. Its IUPAC name is (Z)-but-2-ene;(E)-3-[4-(3-phenylprop-1-en-2-ylamino)phenyl]prop-2-enoic acid.
Molecular Properties
| Compound Name | (Z)-but-2-ene;(E)-3-[4-(3-phenylprop-1-en-2-ylamino)phenyl]prop-2-enoic acid |
| PubChem CID | 143093733 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | (Z)-but-2-ene;(E)-3-[4-(3-phenylprop-1-en-2-ylamino)phenyl]prop-2-enoic acid |
| SMILES | C/C=C\C.C=C(Cc1ccccc1)Nc1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C18H17NO2.C4H8/c1-14(13-16-5-3-2-4-6-16)19-17-10-7-15(8-11-17)9-12-18(20)21;1-3-4-2/h2-12,19H,1,13H2,(H,20,21);3-4H,1-2H3/b12-9+;4-3- |
| InChIKey | RYKKPLSOIZQXBK-RGRSLBHRSA-N |
| XLogP | 5.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-ene;(E)-3-[4-(3-phenylprop-1-en-2-ylamino)phenyl]prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-ene;(E)-3-[4-(3-phenylprop-1-en-2-ylamino)phenyl]prop-2-enoic acid?
The IUPAC name of (Z)-but-2-ene;(E)-3-[4-(3-phenylprop-1-en-2-ylamino)phenyl]prop-2-enoic acid (CID 143093733) is (Z)-but-2-ene;(E)-3-[4-(3-phenylprop-1-en-2-ylamino)phenyl]prop-2-enoic acid.
What is the SMILES notation for (Z)-but-2-ene;(E)-3-[4-(3-phenylprop-1-en-2-ylamino)phenyl]prop-2-enoic acid?
The canonical SMILES for (Z)-but-2-ene;(E)-3-[4-(3-phenylprop-1-en-2-ylamino)phenyl]prop-2-enoic acid is C/C=C\C.C=C(Cc1ccccc1)Nc1ccc(/C=C/C(=O)O)cc1.
What is the InChIKey of (Z)-but-2-ene;(E)-3-[4-(3-phenylprop-1-en-2-ylamino)phenyl]prop-2-enoic acid?
The InChIKey is RYKKPLSOIZQXBK-RGRSLBHRSA-N. The full InChI is InChI=1S/C18H17NO2.C4H8/c1-14(13-16-5-3-2-4-6-16)19-17-10-7-15(8-11-17)9-12-18(20)21;1-3-4-2/h2-12,19H,1,13H2,(H,20,21);3-4H,1-2H3/b12-9+;4-3-.
What are the key properties of (Z)-but-2-ene;(E)-3-[4-(3-phenylprop-1-en-2-ylamino)phenyl]prop-2-enoic acid?
(Z)-but-2-ene;(E)-3-[4-(3-phenylprop-1-en-2-ylamino)phenyl]prop-2-enoic acid has a molecular weight of 335.45 g/mol, XLogP of 5.54, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-ene;(E)-3-[4-(3-phenylprop-1-en-2-ylamino)phenyl]prop-2-enoic acid is sourced from PubChem (CID 143093733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).