About 2-amino-N-[4-[(E)-3-oxoprop-1-enyl]phenyl]propanamide;butane
2-amino-N-[4-[(E)-3-oxoprop-1-enyl]phenyl]propanamide;butane (PubChem CID 143093741) has the molecular formula C16H24N2O2
and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-amino-N-[4-[(E)-3-oxoprop-1-enyl]phenyl]propanamide;butane.
Molecular Properties
| Compound Name | 2-amino-N-[4-[(E)-3-oxoprop-1-enyl]phenyl]propanamide;butane |
| PubChem CID | 143093741 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 2-amino-N-[4-[(E)-3-oxoprop-1-enyl]phenyl]propanamide;butane |
| SMILES | CC(N)C(=O)Nc1ccc(/C=C/C=O)cc1.CCCC |
| InChI | InChI=1S/C12H14N2O2.C4H10/c1-9(13)12(16)14-11-6-4-10(5-7-11)3-2-8-15;1-3-4-2/h2-9H,13H2,1H3,(H,14,16);3-4H2,1-2H3/b3-2+; |
| InChIKey | QPGVENQJAXDQAP-SQQVDAMQSA-N |
| XLogP | 2.99 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-[4-[(E)-3-oxoprop-1-enyl]phenyl]propanamide;butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[4-[(E)-3-oxoprop-1-enyl]phenyl]propanamide;butane?
The IUPAC name of 2-amino-N-[4-[(E)-3-oxoprop-1-enyl]phenyl]propanamide;butane (CID 143093741) is 2-amino-N-[4-[(E)-3-oxoprop-1-enyl]phenyl]propanamide;butane.
What is the SMILES notation for 2-amino-N-[4-[(E)-3-oxoprop-1-enyl]phenyl]propanamide;butane?
The canonical SMILES for 2-amino-N-[4-[(E)-3-oxoprop-1-enyl]phenyl]propanamide;butane is CC(N)C(=O)Nc1ccc(/C=C/C=O)cc1.CCCC.
What is the InChIKey of 2-amino-N-[4-[(E)-3-oxoprop-1-enyl]phenyl]propanamide;butane?
The InChIKey is QPGVENQJAXDQAP-SQQVDAMQSA-N. The full InChI is InChI=1S/C12H14N2O2.C4H10/c1-9(13)12(16)14-11-6-4-10(5-7-11)3-2-8-15;1-3-4-2/h2-9H,13H2,1H3,(H,14,16);3-4H2,1-2H3/b3-2+;.
What are the key properties of 2-amino-N-[4-[(E)-3-oxoprop-1-enyl]phenyl]propanamide;butane?
2-amino-N-[4-[(E)-3-oxoprop-1-enyl]phenyl]propanamide;butane has a molecular weight of 276.38 g/mol, XLogP of 2.99, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[4-[(E)-3-oxoprop-1-enyl]phenyl]propanamide;butane is sourced from PubChem (CID 143093741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).