C18H24N2O2 — CID 143093965
ethene;2-[1-(4-ethenylpiperidin-1-yl)ethenylamino]benzoic acid (PubChem CID 143093965) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is ethene;2-[1-(4-ethenylpiperidin-1-yl)ethenylamino]benzoic acid.
| Compound Name | ethene;2-[1-(4-ethenylpiperidin-1-yl)ethenylamino]benzoic acid |
|---|---|
| PubChem CID | 143093965 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | ethene;2-[1-(4-ethenylpiperidin-1-yl)ethenylamino]benzoic acid |
| SMILES | C=C.C=CC1CCN(C(=C)Nc2ccccc2C(=O)O)CC1 |
| InChI | InChI=1S/C16H20N2O2.C2H4/c1-3-13-8-10-18(11-9-13)12(2)17-15-7-5-4-6-14(15)16(19)20;1-2/h3-7,13,17H,1-2,8-11H2,(H,19,20);1-2H2 |
| InChIKey | KBJKTVZBTZVVEA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|