C20H26N2O4 — CID 143093990
2-phenylethanamine;2,2,8-trimethyl-7-nitro-3,4-dihydrochromen-3-ol (PubChem CID 143093990) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is 2-phenylethanamine;2,2,8-trimethyl-7-nitro-3,4-dihydrochromen-3-ol.
| Compound Name | 2-phenylethanamine;2,2,8-trimethyl-7-nitro-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 143093990 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 2-phenylethanamine;2,2,8-trimethyl-7-nitro-3,4-dihydrochromen-3-ol |
| SMILES | Cc1c([N+](=O)[O-])ccc2c1OC(C)(C)C(O)C2.NCCc1ccccc1 |
| InChI | InChI=1S/C12H15NO4.C8H11N/c1-7-9(13(15)16)5-4-8-6-10(14)12(2,3)17-11(7)8;9-7-6-8-4-2-1-3-5-8/h4-5,10,14H,6H2,1-3H3;1-5H,6-7,9H2 |
| InChIKey | CULDELWQXBPOPY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 98.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|