About N-ethyl-N-methylcyclohepta-1,3,4,6-tetraen-1-amine
N-ethyl-N-methylcyclohepta-1,3,4,6-tetraen-1-amine (PubChem CID 143094072) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is N-ethyl-N-methylcyclohepta-1,3,4,6-tetraen-1-amine.
Analyze N-ethyl-N-methylcyclohepta-1,3,4,6-tetraen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methylcyclohepta-1,3,4,6-tetraen-1-amine?
The IUPAC name of N-ethyl-N-methylcyclohepta-1,3,4,6-tetraen-1-amine (CID 143094072) is N-ethyl-N-methylcyclohepta-1,3,4,6-tetraen-1-amine.
What is the SMILES notation for N-ethyl-N-methylcyclohepta-1,3,4,6-tetraen-1-amine?
The canonical SMILES for N-ethyl-N-methylcyclohepta-1,3,4,6-tetraen-1-amine is CCN(C)C1=CC=C=CC=C1.
What is the InChIKey of N-ethyl-N-methylcyclohepta-1,3,4,6-tetraen-1-amine?
The InChIKey is KPZXDLWMGOADSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c1-3-11(2)10-8-6-4-5-7-9-10/h4,6-9H,3H2,1-2H3.
What are the key properties of N-ethyl-N-methylcyclohepta-1,3,4,6-tetraen-1-amine?
N-ethyl-N-methylcyclohepta-1,3,4,6-tetraen-1-amine has a molecular weight of 147.22 g/mol, XLogP of 2.10, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methylcyclohepta-1,3,4,6-tetraen-1-amine is sourced from PubChem (CID 143094072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).