About (2E,4Z)-1-chloro-N-ethylhexa-2,4-dien-3-amine
(2E,4Z)-1-chloro-N-ethylhexa-2,4-dien-3-amine (PubChem CID 143094103) has the molecular formula C8H14ClN
and a molecular weight of 159.66 g/mol. Its IUPAC name is (2E,4Z)-1-chloro-N-ethylhexa-2,4-dien-3-amine.
Molecular Properties
| Compound Name | (2E,4Z)-1-chloro-N-ethylhexa-2,4-dien-3-amine |
| PubChem CID | 143094103 |
| Molecular Formula | C8H14ClN |
| Molecular Weight | 159.66 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | (2E,4Z)-1-chloro-N-ethylhexa-2,4-dien-3-amine |
| SMILES | C/C=C\C(=C/CCl)NCC |
| InChI | InChI=1S/C8H14ClN/c1-3-5-8(6-7-9)10-4-2/h3,5-6,10H,4,7H2,1-2H3/b5-3-,8-6+ |
| InChIKey | UMRZYBJCNSGCBD-CUKJDEOPSA-N |
| XLogP | 2.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.66 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-1-chloro-N-ethylhexa-2,4-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-1-chloro-N-ethylhexa-2,4-dien-3-amine?
The IUPAC name of (2E,4Z)-1-chloro-N-ethylhexa-2,4-dien-3-amine (CID 143094103) is (2E,4Z)-1-chloro-N-ethylhexa-2,4-dien-3-amine.
What is the SMILES notation for (2E,4Z)-1-chloro-N-ethylhexa-2,4-dien-3-amine?
The canonical SMILES for (2E,4Z)-1-chloro-N-ethylhexa-2,4-dien-3-amine is C/C=C\C(=C/CCl)NCC.
What is the InChIKey of (2E,4Z)-1-chloro-N-ethylhexa-2,4-dien-3-amine?
The InChIKey is UMRZYBJCNSGCBD-CUKJDEOPSA-N. The full InChI is InChI=1S/C8H14ClN/c1-3-5-8(6-7-9)10-4-2/h3,5-6,10H,4,7H2,1-2H3/b5-3-,8-6+.
What are the key properties of (2E,4Z)-1-chloro-N-ethylhexa-2,4-dien-3-amine?
(2E,4Z)-1-chloro-N-ethylhexa-2,4-dien-3-amine has a molecular weight of 159.66 g/mol, XLogP of 2.29, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-1-chloro-N-ethylhexa-2,4-dien-3-amine is sourced from PubChem (CID 143094103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).