C32H25ClF3N3 — CID 143094843
4-[[4-(2-chloro-4-methylphenyl)-2-[(E)-2-[4-[3-(trifluoromethyl)phenyl]phenyl]ethenyl]imidazol-1-yl]methyl]aniline (PubChem CID 143094843) has the molecular formula C32H25ClF3N3 and a molecular weight of 544.02 g/mol. Its IUPAC name is 4-[[4-(2-chloro-4-methylphenyl)-2-[(E)-2-[4-[3-(trifluoromethyl)phenyl]phenyl]ethenyl]imidazol-1-yl]methyl]aniline.
| Compound Name | 4-[[4-(2-chloro-4-methylphenyl)-2-[(E)-2-[4-[3-(trifluoromethyl)phenyl]phenyl]ethenyl]imidazol-1-yl]methyl]aniline |
|---|---|
| PubChem CID | 143094843 |
| Molecular Formula | C32H25ClF3N3 |
| Molecular Weight | 544.02 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | 4-[[4-(2-chloro-4-methylphenyl)-2-[(E)-2-[4-[3-(trifluoromethyl)phenyl]phenyl]ethenyl]imidazol-1-yl]methyl]aniline |
| SMILES | Cc1ccc(-c2cn(Cc3ccc(N)cc3)c(/C=C/c3ccc(-c4cccc(C(F)(F)F)c4)cc3)n2)c(Cl)c1 |
| InChI | InChI=1S/C32H25ClF3N3/c1-21-5-15-28(29(33)17-21)30-20-39(19-23-8-13-27(37)14-9-23)31(38-30)16-10-22-6-11-24(12-7-22)25-3-2-4-26(18-25)32(34,35)36/h2-18,20H,19,37H2,1H3/b16-10+ |
| InChIKey | ULTJIVIMAVZYAP-MHWRWJLKSA-N |
| XLogP | 9.00 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.02 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|