C34H29Cl2FN3O3S+ — CID 143094918
CID 143094918 (PubChem CID 143094918) has the molecular formula C34H29Cl2FN3O3S+ and a molecular weight of 649.60 g/mol.
| Compound Name | CID 143094918 |
|---|---|
| PubChem CID | 143094918 |
| Molecular Formula | C34H29Cl2FN3O3S+ |
| Molecular Weight | 649.60 g/mol |
| Exact Mass | 648.13 |
| IUPAC Name | — |
| SMILES | CC(C)[SH+](=O)Nc1cc(-c2ccc(/C=C/c3nc(-c4ccc(Cl)cc4Cl)cn3Cc3ccc(C(=O)O)cc3)cc2)ccc1F |
| InChI | InChI=1S/C34H28Cl2FN3O3S/c1-21(2)44(43)39-31-17-26(12-15-30(31)37)24-8-3-22(4-9-24)7-16-33-38-32(28-14-13-27(35)18-29(28)36)20-40(33)19-23-5-10-25(11-6-23)34(41)42/h3-18,20-21H,19H2,1-2H3,(H,39,43)(H,41,42)/p+1/b16-7+ |
| InChIKey | SVMMFWIDELVBOX-FRKPEAEDSA-O |
| XLogP | 9.01 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.60 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|