About ethyl 5-ethyl-2-methyl-2,3-dihydrothiophene-3-carboxylate
ethyl 5-ethyl-2-methyl-2,3-dihydrothiophene-3-carboxylate (PubChem CID 143095546) has the molecular formula C10H16O2S
and a molecular weight of 200.30 g/mol. Its IUPAC name is ethyl 5-ethyl-2-methyl-2,3-dihydrothiophene-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-ethyl-2-methyl-2,3-dihydrothiophene-3-carboxylate |
| PubChem CID | 143095546 |
| Molecular Formula | C10H16O2S |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | ethyl 5-ethyl-2-methyl-2,3-dihydrothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1C=C(CC)SC1C |
| InChI | InChI=1S/C10H16O2S/c1-4-8-6-9(7(3)13-8)10(11)12-5-2/h6-7,9H,4-5H2,1-3H3 |
| InChIKey | WORSCEFZMODGJY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 5-ethyl-2-methyl-2,3-dihydrothiophene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-ethyl-2-methyl-2,3-dihydrothiophene-3-carboxylate?
The IUPAC name of ethyl 5-ethyl-2-methyl-2,3-dihydrothiophene-3-carboxylate (CID 143095546) is ethyl 5-ethyl-2-methyl-2,3-dihydrothiophene-3-carboxylate.
What is the SMILES notation for ethyl 5-ethyl-2-methyl-2,3-dihydrothiophene-3-carboxylate?
The canonical SMILES for ethyl 5-ethyl-2-methyl-2,3-dihydrothiophene-3-carboxylate is CCOC(=O)C1C=C(CC)SC1C.
What is the InChIKey of ethyl 5-ethyl-2-methyl-2,3-dihydrothiophene-3-carboxylate?
The InChIKey is WORSCEFZMODGJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2S/c1-4-8-6-9(7(3)13-8)10(11)12-5-2/h6-7,9H,4-5H2,1-3H3.
What are the key properties of ethyl 5-ethyl-2-methyl-2,3-dihydrothiophene-3-carboxylate?
ethyl 5-ethyl-2-methyl-2,3-dihydrothiophene-3-carboxylate has a molecular weight of 200.30 g/mol, XLogP of 2.59, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-ethyl-2-methyl-2,3-dihydrothiophene-3-carboxylate is sourced from PubChem (CID 143095546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).