C25H40O3S — CID 143095817
(6R,7R)-6-(benzenesulfonylmethyl)-7-[(1Z)-buta-1,3-dienyl]-2,6-dimethyldodecan-2-ol (PubChem CID 143095817) has the molecular formula C25H40O3S and a molecular weight of 420.66 g/mol. Its IUPAC name is (6R,7R)-6-(benzenesulfonylmethyl)-7-[(1Z)-buta-1,3-dienyl]-2,6-dimethyldodecan-2-ol.
| Compound Name | (6R,7R)-6-(benzenesulfonylmethyl)-7-[(1Z)-buta-1,3-dienyl]-2,6-dimethyldodecan-2-ol |
|---|---|
| PubChem CID | 143095817 |
| Molecular Formula | C25H40O3S |
| Molecular Weight | 420.66 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | (6R,7R)-6-(benzenesulfonylmethyl)-7-[(1Z)-buta-1,3-dienyl]-2,6-dimethyldodecan-2-ol |
| SMILES | C=C/C=C\[C@@H](CCCCC)[C@@](C)(CCCC(C)(C)O)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H40O3S/c1-6-8-11-16-22(15-9-7-2)25(5,20-14-19-24(3,4)26)21-29(27,28)23-17-12-10-13-18-23/h7,9-10,12-13,15,17-18,22,26H,2,6,8,11,14,16,19-21H2,1,3-5H3/b15-9-/t22-,25-/m0/s1 |
| InChIKey | AQVLXLJQWGMHKC-NPTHVVSNSA-N |
| XLogP | 6.35 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.66 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|