About 1-[[(1E,3Z)-cycloocta-1,3-dien-6-yn-1-yl]methoxy]propan-2-one;ethane
1-[[(1E,3Z)-cycloocta-1,3-dien-6-yn-1-yl]methoxy]propan-2-one;ethane (PubChem CID 143096220) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is 1-[[(1E,3Z)-cycloocta-1,3-dien-6-yn-1-yl]methoxy]propan-2-one;ethane.
Molecular Properties
| Compound Name | 1-[[(1E,3Z)-cycloocta-1,3-dien-6-yn-1-yl]methoxy]propan-2-one;ethane |
| PubChem CID | 143096220 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 1-[[(1E,3Z)-cycloocta-1,3-dien-6-yn-1-yl]methoxy]propan-2-one;ethane |
| SMILES | CC.CC(=O)COC/C1=C/C=C\CC#CC1 |
| InChI | InChI=1S/C12H14O2.C2H6/c1-11(13)9-14-10-12-7-5-3-2-4-6-8-12;1-2/h3,5,7H,2,8-10H2,1H3;1-2H3/b5-3-,12-7+; |
| InChIKey | IUXITGRZWHIWLP-SQZNJMCVSA-N |
| XLogP | 2.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[[(1E,3Z)-cycloocta-1,3-dien-6-yn-1-yl]methoxy]propan-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(1E,3Z)-cycloocta-1,3-dien-6-yn-1-yl]methoxy]propan-2-one;ethane?
The IUPAC name of 1-[[(1E,3Z)-cycloocta-1,3-dien-6-yn-1-yl]methoxy]propan-2-one;ethane (CID 143096220) is 1-[[(1E,3Z)-cycloocta-1,3-dien-6-yn-1-yl]methoxy]propan-2-one;ethane.
What is the SMILES notation for 1-[[(1E,3Z)-cycloocta-1,3-dien-6-yn-1-yl]methoxy]propan-2-one;ethane?
The canonical SMILES for 1-[[(1E,3Z)-cycloocta-1,3-dien-6-yn-1-yl]methoxy]propan-2-one;ethane is CC.CC(=O)COC/C1=C/C=C\CC#CC1.
What is the InChIKey of 1-[[(1E,3Z)-cycloocta-1,3-dien-6-yn-1-yl]methoxy]propan-2-one;ethane?
The InChIKey is IUXITGRZWHIWLP-SQZNJMCVSA-N. The full InChI is InChI=1S/C12H14O2.C2H6/c1-11(13)9-14-10-12-7-5-3-2-4-6-8-12;1-2/h3,5,7H,2,8-10H2,1H3;1-2H3/b5-3-,12-7+;.
What are the key properties of 1-[[(1E,3Z)-cycloocta-1,3-dien-6-yn-1-yl]methoxy]propan-2-one;ethane?
1-[[(1E,3Z)-cycloocta-1,3-dien-6-yn-1-yl]methoxy]propan-2-one;ethane has a molecular weight of 220.31 g/mol, XLogP of 2.90, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(1E,3Z)-cycloocta-1,3-dien-6-yn-1-yl]methoxy]propan-2-one;ethane is sourced from PubChem (CID 143096220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).