C14H25NS — CID 143097606
(Z,2E)-5-cyclohexylsulfanyl-2-ethylidenehex-3-en-1-amine (PubChem CID 143097606) has the molecular formula C14H25NS and a molecular weight of 239.43 g/mol. Its IUPAC name is (Z,2E)-5-cyclohexylsulfanyl-2-ethylidenehex-3-en-1-amine.
| Compound Name | (Z,2E)-5-cyclohexylsulfanyl-2-ethylidenehex-3-en-1-amine |
|---|---|
| PubChem CID | 143097606 |
| Molecular Formula | C14H25NS |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | (Z,2E)-5-cyclohexylsulfanyl-2-ethylidenehex-3-en-1-amine |
| SMILES | C/C=C(\C=C/C(C)SC1CCCCC1)CN |
| InChI | InChI=1S/C14H25NS/c1-3-13(11-15)10-9-12(2)16-14-7-5-4-6-8-14/h3,9-10,12,14H,4-8,11,15H2,1-2H3/b10-9-,13-3+ |
| InChIKey | JPGBWGHRHUUNOE-VWBNHAHASA-N |
| XLogP | 3.90 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|