C12H12F3NO4S — CID 143097646
(3-formyl-1,2,4,5-tetrahydro-3-benzazepin-6-yl) trifluoromethanesulfonate (PubChem CID 143097646) has the molecular formula C12H12F3NO4S and a molecular weight of 323.29 g/mol. Its IUPAC name is (3-formyl-1,2,4,5-tetrahydro-3-benzazepin-6-yl) trifluoromethanesulfonate.
| Compound Name | (3-formyl-1,2,4,5-tetrahydro-3-benzazepin-6-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 143097646 |
| Molecular Formula | C12H12F3NO4S |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | (3-formyl-1,2,4,5-tetrahydro-3-benzazepin-6-yl) trifluoromethanesulfonate |
| SMILES | O=CN1CCc2cccc(OS(=O)(=O)C(F)(F)F)c2CC1 |
| InChI | InChI=1S/C12H12F3NO4S/c13-12(14,15)21(18,19)20-11-3-1-2-9-4-6-16(8-17)7-5-10(9)11/h1-3,8H,4-7H2 |
| InChIKey | DBZLZSHVNLARIC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|