C13H19Br2NO4S — CID 143097971
2-[4,5-dibromo-2-(4,4-dimethyl-1,3-oxazolidin-2-yl)thiophen-3-yl]oxyacetaldehyde;methoxymethane (PubChem CID 143097971) has the molecular formula C13H19Br2NO4S and a molecular weight of 445.17 g/mol. Its IUPAC name is 2-[4,5-dibromo-2-(4,4-dimethyl-1,3-oxazolidin-2-yl)thiophen-3-yl]oxyacetaldehyde;methoxymethane.
| Compound Name | 2-[4,5-dibromo-2-(4,4-dimethyl-1,3-oxazolidin-2-yl)thiophen-3-yl]oxyacetaldehyde;methoxymethane |
|---|---|
| PubChem CID | 143097971 |
| Molecular Formula | C13H19Br2NO4S |
| Molecular Weight | 445.17 g/mol |
| Exact Mass | 442.94 |
| IUPAC Name | 2-[4,5-dibromo-2-(4,4-dimethyl-1,3-oxazolidin-2-yl)thiophen-3-yl]oxyacetaldehyde;methoxymethane |
| SMILES | CC1(C)COC(c2sc(Br)c(Br)c2OCC=O)N1.COC |
| InChI | InChI=1S/C11H13Br2NO3S.C2H6O/c1-11(2)5-17-10(14-11)8-7(16-4-3-15)6(12)9(13)18-8;1-3-2/h3,10,14H,4-5H2,1-2H3;1-2H3 |
| InChIKey | AJKSVSSOGDUIHC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.17 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|