C34H32FNO4 — CID 143098331
(5Z)-5-[[3-[(1E,3E,5Z)-4-fluorohepta-1,3,5-trienoxy]phenyl]methylidene]-10-methoxy-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-9-ol (PubChem CID 143098331) has the molecular formula C34H32FNO4 and a molecular weight of 537.63 g/mol. Its IUPAC name is (5Z)-5-[[3-[(1E,3E,5Z)-4-fluorohepta-1,3,5-trienoxy]phenyl]methylidene]-10-methoxy-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-9-ol.
| Compound Name | (5Z)-5-[[3-[(1E,3E,5Z)-4-fluorohepta-1,3,5-trienoxy]phenyl]methylidene]-10-methoxy-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-9-ol |
|---|---|
| PubChem CID | 143098331 |
| Molecular Formula | C34H32FNO4 |
| Molecular Weight | 537.63 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | (5Z)-5-[[3-[(1E,3E,5Z)-4-fluorohepta-1,3,5-trienoxy]phenyl]methylidene]-10-methoxy-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-9-ol |
| SMILES | C/C=C\C(F)=C/C=C/Oc1cccc(/C=C2\Oc3ccc(O)c(OC)c3-c3ccc4c(c32)C(C)=CC(C)(C)N4)c1 |
| InChI | InChI=1S/C34H32FNO4/c1-6-9-23(35)11-8-17-39-24-12-7-10-22(18-24)19-29-31-25(32-28(40-29)16-15-27(37)33(32)38-5)13-14-26-30(31)21(2)20-34(3,4)36-26/h6-20,36-37H,1-5H3/b9-6-,17-8+,23-11+,29-19- |
| InChIKey | MHAYYMUUTOVMTE-VSRLGKLOSA-N |
| XLogP | 8.89 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.63 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|