C24H25NO5 — CID 143098759
3-[4-[(3E)-hexa-1,3,5-trien-3-yl]-2-hydroxyphenyl]-N-(3-hydroxy-4-propoxyphenyl)-3-oxopropanamide (PubChem CID 143098759) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is 3-[4-[(3E)-hexa-1,3,5-trien-3-yl]-2-hydroxyphenyl]-N-(3-hydroxy-4-propoxyphenyl)-3-oxopropanamide.
| Compound Name | 3-[4-[(3E)-hexa-1,3,5-trien-3-yl]-2-hydroxyphenyl]-N-(3-hydroxy-4-propoxyphenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 143098759 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 3-[4-[(3E)-hexa-1,3,5-trien-3-yl]-2-hydroxyphenyl]-N-(3-hydroxy-4-propoxyphenyl)-3-oxopropanamide |
| SMILES | C=C/C=C(\C=C)c1ccc(C(=O)CC(=O)Nc2ccc(OCCC)c(O)c2)c(O)c1 |
| InChI | InChI=1S/C24H25NO5/c1-4-7-16(6-3)17-8-10-19(20(26)13-17)21(27)15-24(29)25-18-9-11-23(22(28)14-18)30-12-5-2/h4,6-11,13-14,26,28H,1,3,5,12,15H2,2H3,(H,25,29)/b16-7+ |
| InChIKey | MLXRBFGTQDDKDA-FRKPEAEDSA-N |
| XLogP | 4.85 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|