C21H21ClF3N5O4 — CID 143098836
6-[[(Z)-2-[amino-(3-chloro-2-pyridinyl)amino]-5,5,5-trifluoropent-2-enoyl]amino]-N-propan-2-yl-1,3-benzodioxole-5-carboxamide (PubChem CID 143098836) has the molecular formula C21H21ClF3N5O4 and a molecular weight of 499.88 g/mol. Its IUPAC name is 6-[[(Z)-2-[amino-(3-chloro-2-pyridinyl)amino]-5,5,5-trifluoropent-2-enoyl]amino]-N-propan-2-yl-1,3-benzodioxole-5-carboxamide.
| Compound Name | 6-[[(Z)-2-[amino-(3-chloro-2-pyridinyl)amino]-5,5,5-trifluoropent-2-enoyl]amino]-N-propan-2-yl-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 143098836 |
| Molecular Formula | C21H21ClF3N5O4 |
| Molecular Weight | 499.88 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 6-[[(Z)-2-[amino-(3-chloro-2-pyridinyl)amino]-5,5,5-trifluoropent-2-enoyl]amino]-N-propan-2-yl-1,3-benzodioxole-5-carboxamide |
| SMILES | CC(C)NC(=O)c1cc2c(cc1NC(=O)/C(=C/CC(F)(F)F)N(N)c1ncccc1Cl)OCO2 |
| InChI | InChI=1S/C21H21ClF3N5O4/c1-11(2)28-19(31)12-8-16-17(34-10-33-16)9-14(12)29-20(32)15(5-6-21(23,24)25)30(26)18-13(22)4-3-7-27-18/h3-5,7-9,11H,6,10,26H2,1-2H3,(H,28,31)(H,29,32)/b15-5- |
| InChIKey | HPKQOORQYISCTJ-WCSRMQSCSA-N |
| XLogP | 3.76 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.88 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|