About (2,5-dioxopyrrolidin-1-yl) hypofluorite
(2,5-dioxopyrrolidin-1-yl) hypofluorite (PubChem CID 143099393) has the molecular formula C4H4FNO3
and a molecular weight of 133.08 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) hypofluorite.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) hypofluorite |
| PubChem CID | 143099393 |
| Molecular Formula | C4H4FNO3 |
| Molecular Weight | 133.08 g/mol |
| Exact Mass | 133.02 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) hypofluorite |
| SMILES | O=C1CCC(=O)N1OF |
| InChI | InChI=1S/C4H4FNO3/c5-9-6-3(7)1-2-4(6)8/h1-2H2 |
| InChIKey | OXQCOGSENRWTKQ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.08 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) hypofluorite?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) hypofluorite (CID 143099393) is (2,5-dioxopyrrolidin-1-yl) hypofluorite.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) hypofluorite?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) hypofluorite is O=C1CCC(=O)N1OF.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) hypofluorite?
The InChIKey is OXQCOGSENRWTKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4FNO3/c5-9-6-3(7)1-2-4(6)8/h1-2H2.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) hypofluorite?
(2,5-dioxopyrrolidin-1-yl) hypofluorite has a molecular weight of 133.08 g/mol, XLogP of -0.05, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) hypofluorite is sourced from PubChem (CID 143099393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).