About 4-[(2Z,4Z)-3-chlorohexa-2,4-dien-2-yl]-4-fluoro-1-methylpiperidine
4-[(2Z,4Z)-3-chlorohexa-2,4-dien-2-yl]-4-fluoro-1-methylpiperidine (PubChem CID 143099834) has the molecular formula C12H19ClFN
and a molecular weight of 231.74 g/mol. Its IUPAC name is 4-[(2Z,4Z)-3-chlorohexa-2,4-dien-2-yl]-4-fluoro-1-methylpiperidine.
Molecular Properties
| Compound Name | 4-[(2Z,4Z)-3-chlorohexa-2,4-dien-2-yl]-4-fluoro-1-methylpiperidine |
| PubChem CID | 143099834 |
| Molecular Formula | C12H19ClFN |
| Molecular Weight | 231.74 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 4-[(2Z,4Z)-3-chlorohexa-2,4-dien-2-yl]-4-fluoro-1-methylpiperidine |
| SMILES | C/C=C\C(Cl)=C(/C)C1(F)CCN(C)CC1 |
| InChI | InChI=1S/C12H19ClFN/c1-4-5-11(13)10(2)12(14)6-8-15(3)9-7-12/h4-5H,6-9H2,1-3H3/b5-4-,11-10- |
| InChIKey | AUFJKHBWRWPYPR-NKIGAPEHSA-N |
| XLogP | 3.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.74 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2Z,4Z)-3-chlorohexa-2,4-dien-2-yl]-4-fluoro-1-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2Z,4Z)-3-chlorohexa-2,4-dien-2-yl]-4-fluoro-1-methylpiperidine?
The IUPAC name of 4-[(2Z,4Z)-3-chlorohexa-2,4-dien-2-yl]-4-fluoro-1-methylpiperidine (CID 143099834) is 4-[(2Z,4Z)-3-chlorohexa-2,4-dien-2-yl]-4-fluoro-1-methylpiperidine.
What is the SMILES notation for 4-[(2Z,4Z)-3-chlorohexa-2,4-dien-2-yl]-4-fluoro-1-methylpiperidine?
The canonical SMILES for 4-[(2Z,4Z)-3-chlorohexa-2,4-dien-2-yl]-4-fluoro-1-methylpiperidine is C/C=C\C(Cl)=C(/C)C1(F)CCN(C)CC1.
What is the InChIKey of 4-[(2Z,4Z)-3-chlorohexa-2,4-dien-2-yl]-4-fluoro-1-methylpiperidine?
The InChIKey is AUFJKHBWRWPYPR-NKIGAPEHSA-N. The full InChI is InChI=1S/C12H19ClFN/c1-4-5-11(13)10(2)12(14)6-8-15(3)9-7-12/h4-5H,6-9H2,1-3H3/b5-4-,11-10-.
What are the key properties of 4-[(2Z,4Z)-3-chlorohexa-2,4-dien-2-yl]-4-fluoro-1-methylpiperidine?
4-[(2Z,4Z)-3-chlorohexa-2,4-dien-2-yl]-4-fluoro-1-methylpiperidine has a molecular weight of 231.74 g/mol, XLogP of 3.51, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2Z,4Z)-3-chlorohexa-2,4-dien-2-yl]-4-fluoro-1-methylpiperidine is sourced from PubChem (CID 143099834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).