C32H35F3N4 — CID 143100346
2-(4-butan-2-ylphenyl)guanidine;(E)-1,1,1-trifluoro-N-methyl-5-phenanthren-2-ylhex-4-en-2-imine (PubChem CID 143100346) has the molecular formula C32H35F3N4 and a molecular weight of 532.65 g/mol. Its IUPAC name is 2-(4-butan-2-ylphenyl)guanidine;(E)-1,1,1-trifluoro-N-methyl-5-phenanthren-2-ylhex-4-en-2-imine.
| Compound Name | 2-(4-butan-2-ylphenyl)guanidine;(E)-1,1,1-trifluoro-N-methyl-5-phenanthren-2-ylhex-4-en-2-imine |
|---|---|
| PubChem CID | 143100346 |
| Molecular Formula | C32H35F3N4 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | 2-(4-butan-2-ylphenyl)guanidine;(E)-1,1,1-trifluoro-N-methyl-5-phenanthren-2-ylhex-4-en-2-imine |
| SMILES | C/N=C(/C/C=C(\C)c1ccc2c(ccc3ccccc32)c1)C(F)(F)F.CCC(C)c1ccc(N=C(N)N)cc1 |
| InChI | InChI=1S/C21H18F3N.C11H17N3/c1-14(7-12-20(25-2)21(22,23)24)16-10-11-19-17(13-16)9-8-15-5-3-4-6-18(15)19;1-3-8(2)9-4-6-10(7-5-9)14-11(12)13/h3-11,13H,12H2,1-2H3;4-8H,3H2,1-2H3,(H4,12,13,14)/b14-7+,25-20-; |
| InChIKey | KGYMGXWXRGHYDY-NFUZYXISSA-N |
| XLogP | 8.52 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|