C34H57N7O7S2+2 — CID 143100748
CID 143100748 (PubChem CID 143100748) has the molecular formula C34H57N7O7S2+2 and a molecular weight of 740.01 g/mol.
| Compound Name | CID 143100748 |
|---|---|
| PubChem CID | 143100748 |
| Molecular Formula | C34H57N7O7S2+2 |
| Molecular Weight | 740.01 g/mol |
| Exact Mass | 739.37 |
| IUPAC Name | — |
| SMILES | C#CCSC(NC(=O)[C@@H]1C(=C=C(C)C)CCN1C(=O)[C@@H](NC(=O)N[C@H](C[NH2+]CCN(C)[SH+](=O)O)C(C)(C)C)C(C)(C)C)C(=O)C(=O)NCC=C |
| InChI | InChI=1S/C34H55N7O7S2/c1-12-15-36-29(44)26(42)30(49-19-13-2)39-28(43)25-23(20-22(3)4)14-17-41(25)31(45)27(34(8,9)10)38-32(46)37-24(33(5,6)7)21-35-16-18-40(11)50(47)48/h2,12,24-25,27,30,35H,1,14-19,21H2,3-11H3,(H,36,44)(H,39,43)(H,47,48)(H2,37,38,46)/p+2/t24-,25+,27-,30?/m1/s1 |
| InChIKey | UWAYYHAUMGOABR-BBPVOIOOSA-P |
| XLogP | 0.47 |
| TPSA | 193.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.01 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|