About propane;N-prop-1-en-2-ylhept-1-en-3-imine
propane;N-prop-1-en-2-ylhept-1-en-3-imine (PubChem CID 143101176) has the molecular formula C13H25N
and a molecular weight of 195.35 g/mol. Its IUPAC name is propane;N-prop-1-en-2-ylhept-1-en-3-imine.
Molecular Properties
| Compound Name | propane;N-prop-1-en-2-ylhept-1-en-3-imine |
| PubChem CID | 143101176 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | propane;N-prop-1-en-2-ylhept-1-en-3-imine |
| SMILES | C=C/C(CCCC)=N\C(=C)C.CCC |
| InChI | InChI=1S/C10H17N.C3H8/c1-5-7-8-10(6-2)11-9(3)4;1-3-2/h6H,2-3,5,7-8H2,1,4H3;3H2,1-2H3/b11-10+; |
| InChIKey | GREPGRWJWGDEMH-ASTDGNLGSA-N |
| XLogP | 4.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze propane;N-prop-1-en-2-ylhept-1-en-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;N-prop-1-en-2-ylhept-1-en-3-imine?
The IUPAC name of propane;N-prop-1-en-2-ylhept-1-en-3-imine (CID 143101176) is propane;N-prop-1-en-2-ylhept-1-en-3-imine.
What is the SMILES notation for propane;N-prop-1-en-2-ylhept-1-en-3-imine?
The canonical SMILES for propane;N-prop-1-en-2-ylhept-1-en-3-imine is C=C/C(CCCC)=N\C(=C)C.CCC.
What is the InChIKey of propane;N-prop-1-en-2-ylhept-1-en-3-imine?
The InChIKey is GREPGRWJWGDEMH-ASTDGNLGSA-N. The full InChI is InChI=1S/C10H17N.C3H8/c1-5-7-8-10(6-2)11-9(3)4;1-3-2/h6H,2-3,5,7-8H2,1,4H3;3H2,1-2H3/b11-10+;.
What are the key properties of propane;N-prop-1-en-2-ylhept-1-en-3-imine?
propane;N-prop-1-en-2-ylhept-1-en-3-imine has a molecular weight of 195.35 g/mol, XLogP of 4.75, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propane;N-prop-1-en-2-ylhept-1-en-3-imine is sourced from PubChem (CID 143101176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).