About acetylene;(2S,4S)-2,4-dimethyloxane;methanol
acetylene;(2S,4S)-2,4-dimethyloxane;methanol (PubChem CID 143101245) has the molecular formula C10H20O2
and a molecular weight of 172.27 g/mol. Its IUPAC name is acetylene;(2S,4S)-2,4-dimethyloxane;methanol.
Molecular Properties
| Compound Name | acetylene;(2S,4S)-2,4-dimethyloxane;methanol |
| PubChem CID | 143101245 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | acetylene;(2S,4S)-2,4-dimethyloxane;methanol |
| SMILES | C#C.CO.C[C@H]1CCO[C@@H](C)C1 |
| InChI | InChI=1S/C7H14O.C2H2.CH4O/c1-6-3-4-8-7(2)5-6;2*1-2/h6-7H,3-5H2,1-2H3;1-2H;2H,1H3/t6-,7-;;/m0../s1 |
| InChIKey | PDNXCSFGZMLLAX-JFYKYWLVSA-N |
| XLogP | 1.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;(2S,4S)-2,4-dimethyloxane;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;(2S,4S)-2,4-dimethyloxane;methanol?
The IUPAC name of acetylene;(2S,4S)-2,4-dimethyloxane;methanol (CID 143101245) is acetylene;(2S,4S)-2,4-dimethyloxane;methanol.
What is the SMILES notation for acetylene;(2S,4S)-2,4-dimethyloxane;methanol?
The canonical SMILES for acetylene;(2S,4S)-2,4-dimethyloxane;methanol is C#C.CO.C[C@H]1CCO[C@@H](C)C1.
What is the InChIKey of acetylene;(2S,4S)-2,4-dimethyloxane;methanol?
The InChIKey is PDNXCSFGZMLLAX-JFYKYWLVSA-N. The full InChI is InChI=1S/C7H14O.C2H2.CH4O/c1-6-3-4-8-7(2)5-6;2*1-2/h6-7H,3-5H2,1-2H3;1-2H;2H,1H3/t6-,7-;;/m0../s1.
What are the key properties of acetylene;(2S,4S)-2,4-dimethyloxane;methanol?
acetylene;(2S,4S)-2,4-dimethyloxane;methanol has a molecular weight of 172.27 g/mol, XLogP of 1.68, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;(2S,4S)-2,4-dimethyloxane;methanol is sourced from PubChem (CID 143101245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).