C7H15NO2 — CID 143101362
O-[(2S,4S,6R)-4,6-dimethyloxan-2-yl]hydroxylamine (PubChem CID 143101362) has the molecular formula C7H15NO2 and a molecular weight of 145.20 g/mol. Its IUPAC name is O-[(2S,4S,6R)-4,6-dimethyloxan-2-yl]hydroxylamine.
| Compound Name | O-[(2S,4S,6R)-4,6-dimethyloxan-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 143101362 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | O-[(2S,4S,6R)-4,6-dimethyloxan-2-yl]hydroxylamine |
| SMILES | C[C@@H]1C[C@H](ON)O[C@H](C)C1 |
| InChI | InChI=1S/C7H15NO2/c1-5-3-6(2)9-7(4-5)10-8/h5-7H,3-4,8H2,1-2H3/t5-,6+,7-/m0/s1 |
| InChIKey | FHPACUDPXVAYTL-XVMARJQXSA-N |
| XLogP | 1.04 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|