C21H31N5O6 — CID 143101389
(2R,3R,4S,6R)-4-[2-[1-[(2S)-1-hydroxy-3-(4-nitrophenyl)propan-2-yl]triazol-4-yl]ethyl-methylamino]-2-methoxy-6-methyloxan-3-ol (PubChem CID 143101389) has the molecular formula C21H31N5O6 and a molecular weight of 449.51 g/mol. Its IUPAC name is (2R,3R,4S,6R)-4-[2-[1-[(2S)-1-hydroxy-3-(4-nitrophenyl)propan-2-yl]triazol-4-yl]ethyl-methylamino]-2-methoxy-6-methyloxan-3-ol.
| Compound Name | (2R,3R,4S,6R)-4-[2-[1-[(2S)-1-hydroxy-3-(4-nitrophenyl)propan-2-yl]triazol-4-yl]ethyl-methylamino]-2-methoxy-6-methyloxan-3-ol |
|---|---|
| PubChem CID | 143101389 |
| Molecular Formula | C21H31N5O6 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | (2R,3R,4S,6R)-4-[2-[1-[(2S)-1-hydroxy-3-(4-nitrophenyl)propan-2-yl]triazol-4-yl]ethyl-methylamino]-2-methoxy-6-methyloxan-3-ol |
| SMILES | CO[C@@H]1O[C@H](C)C[C@H](N(C)CCc2cn([C@H](CO)Cc3ccc([N+](=O)[O-])cc3)nn2)[C@H]1O |
| InChI | InChI=1S/C21H31N5O6/c1-14-10-19(20(28)21(31-3)32-14)24(2)9-8-16-12-25(23-22-16)18(13-27)11-15-4-6-17(7-5-15)26(29)30/h4-7,12,14,18-21,27-28H,8-11,13H2,1-3H3/t14-,18+,19+,20-,21-/m1/s1 |
| InChIKey | JKAQPDDELVWIQE-NKXUHPISSA-N |
| XLogP | 0.95 |
| TPSA | 136.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|