C26H36F3N5O8 — CID 143101993
furan-2-ylmethyl 2-[[(2S)-1-[(2S,4R)-2-[(1-amino-6,6,6-trifluoro-1,2-dioxohexan-3-yl)carbamoyl]-4-methylpyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamoylamino]acetate (PubChem CID 143101993) has the molecular formula C26H36F3N5O8 and a molecular weight of 603.60 g/mol. Its IUPAC name is furan-2-ylmethyl 2-[[(2S)-1-[(2S,4R)-2-[(1-amino-6,6,6-trifluoro-1,2-dioxohexan-3-yl)carbamoyl]-4-methylpyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamoylamino]acetate.
| Compound Name | furan-2-ylmethyl 2-[[(2S)-1-[(2S,4R)-2-[(1-amino-6,6,6-trifluoro-1,2-dioxohexan-3-yl)carbamoyl]-4-methylpyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 143101993 |
| Molecular Formula | C26H36F3N5O8 |
| Molecular Weight | 603.60 g/mol |
| Exact Mass | 603.25 |
| IUPAC Name | furan-2-ylmethyl 2-[[(2S)-1-[(2S,4R)-2-[(1-amino-6,6,6-trifluoro-1,2-dioxohexan-3-yl)carbamoyl]-4-methylpyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamoylamino]acetate |
| SMILES | C[C@@H]1C[C@@H](C(=O)NC(CCC(F)(F)F)C(=O)C(N)=O)N(C(=O)[C@@H](NC(=O)NCC(=O)OCc2ccco2)C(C)(C)C)C1 |
| InChI | InChI=1S/C26H36F3N5O8/c1-14-10-17(22(38)32-16(19(36)21(30)37)7-8-26(27,28)29)34(12-14)23(39)20(25(2,3)4)33-24(40)31-11-18(35)42-13-15-6-5-9-41-15/h5-6,9,14,16-17,20H,7-8,10-13H2,1-4H3,(H2,30,37)(H,32,38)(H2,31,33,40)/t14-,16?,17+,20-/m1/s1 |
| InChIKey | DMFUSEWADMWSIL-ASQPVTKTSA-N |
| XLogP | 1.16 |
| TPSA | 190.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.60 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|