C27H45F3N6O6 — CID 143102522
1-[2-[(2-amino-2-oxoethyl)carbamoylamino]-3,3-dimethylbutanoyl]-N-[6,6,6-trifluoro-1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]pyrrolidine-2-carboxamide;2-methylpropane (PubChem CID 143102522) has the molecular formula C27H45F3N6O6 and a molecular weight of 606.69 g/mol. Its IUPAC name is 1-[2-[(2-amino-2-oxoethyl)carbamoylamino]-3,3-dimethylbutanoyl]-N-[6,6,6-trifluoro-1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]pyrrolidine-2-carboxamide;2-methylpropane.
| Compound Name | 1-[2-[(2-amino-2-oxoethyl)carbamoylamino]-3,3-dimethylbutanoyl]-N-[6,6,6-trifluoro-1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]pyrrolidine-2-carboxamide;2-methylpropane |
|---|---|
| PubChem CID | 143102522 |
| Molecular Formula | C27H45F3N6O6 |
| Molecular Weight | 606.69 g/mol |
| Exact Mass | 606.34 |
| IUPAC Name | 1-[2-[(2-amino-2-oxoethyl)carbamoylamino]-3,3-dimethylbutanoyl]-N-[6,6,6-trifluoro-1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]pyrrolidine-2-carboxamide;2-methylpropane |
| SMILES | C=CCNC(=O)C(=O)C(CCC(F)(F)F)NC(=O)C1CCCN1C(=O)C(NC(=O)NCC(N)=O)C(C)(C)C.CC(C)C |
| InChI | InChI=1S/C23H35F3N6O6.C4H10/c1-5-10-28-19(36)16(34)13(8-9-23(24,25)26)30-18(35)14-7-6-11-32(14)20(37)17(22(2,3)4)31-21(38)29-12-15(27)33;1-4(2)3/h5,13-14,17H,1,6-12H2,2-4H3,(H2,27,33)(H,28,36)(H,30,35)(H2,29,31,38);4H,1-3H3 |
| InChIKey | WCDWSZRDEOZTGD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.69 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|